C19H20N6O2S — CID 140578109
N-[(5-phenyl-1,3,4-thiadiazol-2-yl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide (PubChem CID 140578109) has the molecular formula C19H20N6O2S and a molecular weight of 396.48 g/mol. Its IUPAC name is N-[(5-phenyl-1,3,4-thiadiazol-2-yl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide.
| Compound Name | N-[(5-phenyl-1,3,4-thiadiazol-2-yl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140578109 |
| Molecular Formula | C19H20N6O2S |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[(5-phenyl-1,3,4-thiadiazol-2-yl)-pyridin-3-yloxymethyl]piperazine-1-carboxamide |
| SMILES | O=C(NC(Oc1cccnc1)c1nnc(-c2ccccc2)s1)N1CCNCC1 |
| InChI | InChI=1S/C19H20N6O2S/c26-19(25-11-9-20-10-12-25)22-16(27-15-7-4-8-21-13-15)18-24-23-17(28-18)14-5-2-1-3-6-14/h1-8,13,16,20H,9-12H2,(H,22,26) |
| InChIKey | JRXQPOOZWRMRJV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|