About 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-)
2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) (PubChem CID 140578553) has the molecular formula C21H17LiNO-
and a molecular weight of 306.31 g/mol. Its IUPAC name is 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-).
Molecular Properties
| Compound Name | 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) |
| PubChem CID | 140578553 |
| Molecular Formula | C21H17LiNO- |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) |
| SMILES | [LiH2-].[O-]c1ccccc1/[NH+]=C/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H15NO.Li.2H/c23-21-12-6-5-11-20(21)22-14-19-17-9-3-1-7-15(17)13-16-8-2-4-10-18(16)19;;;/h1-14,23H;;;/q;-1;;/b22-14+;;; |
| InChIKey | QHXJMXZLVZIMQG-UZCIDVFDSA-N |
| XLogP | 1.98 |
| TPSA | 37.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-)?
The IUPAC name of 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) (CID 140578553) is 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-).
What is the SMILES notation for 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-)?
The canonical SMILES for 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) is [LiH2-].[O-]c1ccccc1/[NH+]=C/c1c2ccccc2cc2ccccc12.
What is the InChIKey of 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-)?
The InChIKey is QHXJMXZLVZIMQG-UZCIDVFDSA-N. The full InChI is InChI=1S/C21H15NO.Li.2H/c23-21-12-6-5-11-20(21)22-14-19-17-9-3-1-7-15(17)13-16-8-2-4-10-18(16)19;;;/h1-14,23H;;;/q;-1;;/b22-14+;;;.
What are the key properties of 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-)?
2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) has a molecular weight of 306.31 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(anthracen-9-ylmethylideneazaniumyl)phenolate;lithium(1-) is sourced from PubChem (CID 140578553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).