C24H27F3N6O6 — CID 140578628
(2,2,2-trifluoroacetyl) 7-[7-methyl-2,4-dioxo-8-[[(3S)-pyrrolidin-3-yl]amino]benzo[g]pteridin-10-yl]heptaneperoxoate (PubChem CID 140578628) has the molecular formula C24H27F3N6O6 and a molecular weight of 552.51 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 7-[7-methyl-2,4-dioxo-8-[[(3S)-pyrrolidin-3-yl]amino]benzo[g]pteridin-10-yl]heptaneperoxoate.
| Compound Name | (2,2,2-trifluoroacetyl) 7-[7-methyl-2,4-dioxo-8-[[(3S)-pyrrolidin-3-yl]amino]benzo[g]pteridin-10-yl]heptaneperoxoate |
|---|---|
| PubChem CID | 140578628 |
| Molecular Formula | C24H27F3N6O6 |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 7-[7-methyl-2,4-dioxo-8-[[(3S)-pyrrolidin-3-yl]amino]benzo[g]pteridin-10-yl]heptaneperoxoate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCCCCCC(=O)OOC(=O)C(F)(F)F)c2cc1N[C@H]1CCNC1 |
| InChI | InChI=1S/C24H27F3N6O6/c1-13-10-16-17(11-15(13)29-14-7-8-28-12-14)33(20-19(30-16)21(35)32-23(37)31-20)9-5-3-2-4-6-18(34)38-39-22(36)24(25,26)27/h10-11,14,28-29H,2-9,12H2,1H3,(H,32,35,37)/t14-/m0/s1 |
| InChIKey | UQKMYAVSERESLH-AWEZNQCLSA-N |
| XLogP | 2.18 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|