C38H30F6N8RuS — CID 140578643
2,6-dipyridin-2-ylpyridine;4-(5-hexylthiophen-2-yl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;ruthenium(2+) (PubChem CID 140578643) has the molecular formula C38H30F6N8RuS and a molecular weight of 845.84 g/mol. Its IUPAC name is 2,6-dipyridin-2-ylpyridine;4-(5-hexylthiophen-2-yl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;ruthenium(2+).
| Compound Name | 2,6-dipyridin-2-ylpyridine;4-(5-hexylthiophen-2-yl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;ruthenium(2+) |
|---|---|
| PubChem CID | 140578643 |
| Molecular Formula | C38H30F6N8RuS |
| Molecular Weight | 845.84 g/mol |
| Exact Mass | 846.13 |
| IUPAC Name | 2,6-dipyridin-2-ylpyridine;4-(5-hexylthiophen-2-yl)-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine;ruthenium(2+) |
| SMILES | CCCCCCc1ccc(-c2cc(-c3cc(C(F)(F)F)n[n-]3)nc(-c3cc(C(F)(F)F)n[n-]3)c2)s1.[Ru+2].c1ccc(-c2cccc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C23H19F6N5S.C15H11N3.Ru/c1-2-3-4-5-6-14-7-8-19(35-14)13-9-15(17-11-20(33-31-17)22(24,25)26)30-16(10-13)18-12-21(34-32-18)23(27,28)29;1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13;/h7-12H,2-6H2,1H3;1-11H;/q-2;;+2 |
| InChIKey | LHAZZBCCPVWXRG-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.84 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|