C25H23F6N5O2S — CID 140578645
4-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 140578645) has the molecular formula C25H23F6N5O2S and a molecular weight of 571.55 g/mol. Its IUPAC name is 4-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 140578645 |
| Molecular Formula | C25H23F6N5O2S |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.15 |
| IUPAC Name | 4-(7-hexyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,6-bis[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCc1sc(-c2cc(-c3cc(C(F)(F)F)[nH]n3)nc(-c3cc(C(F)(F)F)[nH]n3)c2)c2c1OCCO2 |
| InChI | InChI=1S/C25H23F6N5O2S/c1-2-3-4-5-6-18-21-22(38-8-7-37-21)23(39-18)13-9-14(16-11-19(35-33-16)24(26,27)28)32-15(10-13)17-12-20(36-34-17)25(29,30)31/h9-12H,2-8H2,1H3,(H,33,35)(H,34,36) |
| InChIKey | OABITKVRYRLZBH-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|