C14H11F3N2O2 — CID 140578759
2-(3,3,3-trifluoro-2-hydroxyiminopropyl)naphthalene-1-carboxamide (PubChem CID 140578759) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-(3,3,3-trifluoro-2-hydroxyiminopropyl)naphthalene-1-carboxamide.
| Compound Name | 2-(3,3,3-trifluoro-2-hydroxyiminopropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578759 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-(3,3,3-trifluoro-2-hydroxyiminopropyl)naphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(CC(=NO)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C14H11F3N2O2/c15-14(16,17)11(19-21)7-9-6-5-8-3-1-2-4-10(8)12(9)13(18)20/h1-6,21H,7H2,(H2,18,20) |
| InChIKey | LVEUTYOALNOIDL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|