About 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide
2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide (PubChem CID 140578816) has the molecular formula C20H16F2N2O2
and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide.
Molecular Properties
| Compound Name | 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
| PubChem CID | 140578816 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(CC=NOCc2ccc(F)cc2F)ccc2ccccc12 |
| InChI | InChI=1S/C20H16F2N2O2/c21-16-8-7-15(18(22)11-16)12-26-24-10-9-14-6-5-13-3-1-2-4-17(13)19(14)20(23)25/h1-8,10-11H,9,12H2,(H2,23,25) |
| InChIKey | YIEPGZJEBUIKAG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide?
The IUPAC name of 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide (CID 140578816) is 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide.
What is the SMILES notation for 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide?
The canonical SMILES for 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide is NC(=O)c1c(CC=NOCc2ccc(F)cc2F)ccc2ccccc12.
What is the InChIKey of 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide?
The InChIKey is YIEPGZJEBUIKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N2O2/c21-16-8-7-15(18(22)11-16)12-26-24-10-9-14-6-5-13-3-1-2-4-17(13)19(14)20(23)25/h1-8,10-11H,9,12H2,(H2,23,25).
What are the key properties of 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide?
2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide has a molecular weight of 354.36 g/mol, XLogP of 3.96, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2,4-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide is sourced from PubChem (CID 140578816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).