About [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate
[(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate (PubChem CID 140579399) has the molecular formula C11H20N2O4
and a molecular weight of 244.29 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate |
| PubChem CID | 140579399 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)NOC(=O)C1CCNCC1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)16-10(15)13-17-9(14)8-4-6-12-7-5-8/h8,12H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | CFSRIYPOQYZHQQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate?
The IUPAC name of [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate (CID 140579399) is [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate.
What is the SMILES notation for [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate?
The canonical SMILES for [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate is CC(C)(C)OC(=O)NOC(=O)C1CCNCC1.
What is the InChIKey of [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate?
The InChIKey is CFSRIYPOQYZHQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O4/c1-11(2,3)16-10(15)13-17-9(14)8-4-6-12-7-5-8/h8,12H,4-7H2,1-3H3,(H,13,15).
What are the key properties of [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate?
[(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate has a molecular weight of 244.29 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methylpropan-2-yl)oxycarbonylamino] piperidine-4-carboxylate is sourced from PubChem (CID 140579399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).