About 2,4-dichloro-1,3,5-triazinane
2,4-dichloro-1,3,5-triazinane (PubChem CID 140579479) has the molecular formula C3H7Cl2N3
and a molecular weight of 156.02 g/mol. Its IUPAC name is 2,4-dichloro-1,3,5-triazinane.
Molecular Properties
| Compound Name | 2,4-dichloro-1,3,5-triazinane |
| PubChem CID | 140579479 |
| Molecular Formula | C3H7Cl2N3 |
| Molecular Weight | 156.02 g/mol |
| Exact Mass | 155.00 |
| IUPAC Name | 2,4-dichloro-1,3,5-triazinane |
| SMILES | ClC1NCNC(Cl)N1 |
| InChI | InChI=1S/C3H7Cl2N3/c4-2-6-1-7-3(5)8-2/h2-3,6-8H,1H2 |
| InChIKey | QYWMPGWZNUGGSS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.02 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichloro-1,3,5-triazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-1,3,5-triazinane?
The IUPAC name of 2,4-dichloro-1,3,5-triazinane (CID 140579479) is 2,4-dichloro-1,3,5-triazinane.
What is the SMILES notation for 2,4-dichloro-1,3,5-triazinane?
The canonical SMILES for 2,4-dichloro-1,3,5-triazinane is ClC1NCNC(Cl)N1.
What is the InChIKey of 2,4-dichloro-1,3,5-triazinane?
The InChIKey is QYWMPGWZNUGGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7Cl2N3/c4-2-6-1-7-3(5)8-2/h2-3,6-8H,1H2.
What are the key properties of 2,4-dichloro-1,3,5-triazinane?
2,4-dichloro-1,3,5-triazinane has a molecular weight of 156.02 g/mol, XLogP of -0.23, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-1,3,5-triazinane is sourced from PubChem (CID 140579479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).