C18H20BrClFN3OSi — CID 140579579
1-[[5-bromo-4-chloro-3-(2-fluoro-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140579579) has the molecular formula C18H20BrClFN3OSi and a molecular weight of 456.82 g/mol. Its IUPAC name is 1-[[5-bromo-4-chloro-3-(2-fluoro-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 1-[[5-bromo-4-chloro-3-(2-fluoro-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140579579 |
| Molecular Formula | C18H20BrClFN3OSi |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 1-[[5-bromo-4-chloro-3-(2-fluoro-3-pyridinyl)pyrrolo[2,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(OCn1cc(-c2cccnc2F)c2c(Cl)c(Br)cnc21)[Si](C)(C)C |
| InChI | InChI=1S/C18H20BrClFN3OSi/c1-11(26(2,3)4)25-10-24-9-13(12-6-5-7-22-17(12)21)15-16(20)14(19)8-23-18(15)24/h5-9,11H,10H2,1-4H3 |
| InChIKey | AWGSWNJPLRXNKW-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|