C12H24N2O3 — CID 140579617
1-(diethylamino)-3,5,6,7,8,8a-hexahydro-2H-indolizine-1,7,8-triol (PubChem CID 140579617) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 1-(diethylamino)-3,5,6,7,8,8a-hexahydro-2H-indolizine-1,7,8-triol.
| Compound Name | 1-(diethylamino)-3,5,6,7,8,8a-hexahydro-2H-indolizine-1,7,8-triol |
|---|---|
| PubChem CID | 140579617 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(diethylamino)-3,5,6,7,8,8a-hexahydro-2H-indolizine-1,7,8-triol |
| SMILES | CCN(CC)C1(O)CCN2CCC(O)C(O)C21 |
| InChI | InChI=1S/C12H24N2O3/c1-3-14(4-2)12(17)6-8-13-7-5-9(15)10(16)11(12)13/h9-11,15-17H,3-8H2,1-2H3 |
| InChIKey | GEONJGMFPHUMCJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|