About 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde
5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 140580496) has the molecular formula C9H11FO3
and a molecular weight of 186.18 g/mol. Its IUPAC name is 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 140580496 |
| Molecular Formula | C9H11FO3 |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=CC(F)(OC)CC(C=O)=C1 |
| InChI | InChI=1S/C9H11FO3/c1-12-8-3-7(6-11)4-9(10,5-8)13-2/h3,5-6H,4H2,1-2H3 |
| InChIKey | NBZHPUVMBQCALZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde (CID 140580496) is 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde is COC1=CC(F)(OC)CC(C=O)=C1.
What is the InChIKey of 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is NBZHPUVMBQCALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO3/c1-12-8-3-7(6-11)4-9(10,5-8)13-2/h3,5-6H,4H2,1-2H3.
What are the key properties of 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde?
5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 186.18 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3,5-dimethoxycyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 140580496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).