About dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium
dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium (PubChem CID 140580661) has the molecular formula C12H9Cl2NO4Ru
and a molecular weight of 403.18 g/mol. Its IUPAC name is dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium.
Molecular Properties
| Compound Name | dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium |
| PubChem CID | 140580661 |
| Molecular Formula | C12H9Cl2NO4Ru |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(C=[Ru](Cl)Cl)cc1 |
| InChI | InChI=1S/C12H9NO4.2ClH.Ru/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15;;;/h1-5H,6-7H2;2*1H;/q;;;+2/p-2 |
| InChIKey | CHWNZDJQSZBFNM-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium?
The IUPAC name of dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium (CID 140580661) is dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium.
What is the SMILES notation for dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium?
The canonical SMILES for dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium is O=C(ON1C(=O)CCC1=O)c1ccc(C=[Ru](Cl)Cl)cc1.
What is the InChIKey of dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium?
The InChIKey is CHWNZDJQSZBFNM-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H9NO4.2ClH.Ru/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15;;;/h1-5H,6-7H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium?
dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium has a molecular weight of 403.18 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium is sourced from PubChem (CID 140580661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).