C12H9Cl2NO4Ru — CID 140580661
dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium (PubChem CID 140580661) has the molecular formula C12H9Cl2NO4Ru and a molecular weight of 403.18 g/mol. Its IUPAC name is dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 140580661 |
| Molecular Formula | C12H9Cl2NO4Ru |
| Molecular Weight | 403.18 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | dichloro-[[4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylphenyl]methylidene]ruthenium |
| SMILES | O=C(ON1C(=O)CCC1=O)c1ccc(C=[Ru](Cl)Cl)cc1 |
| InChI | InChI=1S/C12H9NO4.2ClH.Ru/c1-8-2-4-9(5-3-8)12(16)17-13-10(14)6-7-11(13)15;;;/h1-5H,6-7H2;2*1H;/q;;;+2/p-2 |
| InChIKey | CHWNZDJQSZBFNM-UHFFFAOYSA-L |
| XLogP | 1.98 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|