About 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine
2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine (PubChem CID 140580755) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine.
Molecular Properties
| Compound Name | 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine |
| PubChem CID | 140580755 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine |
| SMILES | CCC(C)(C)C1NC(C(C)(C)C)NC1C(C)(C)CC |
| InChI | InChI=1S/C17H36N2/c1-10-16(6,7)12-13(17(8,9)11-2)19-14(18-12)15(3,4)5/h12-14,18-19H,10-11H2,1-9H3 |
| InChIKey | DUBYTIYDSVNNIG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine?
The IUPAC name of 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine (CID 140580755) is 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine.
What is the SMILES notation for 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine?
The canonical SMILES for 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine is CCC(C)(C)C1NC(C(C)(C)C)NC1C(C)(C)CC.
What is the InChIKey of 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine?
The InChIKey is DUBYTIYDSVNNIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2/c1-10-16(6,7)12-13(17(8,9)11-2)19-14(18-12)15(3,4)5/h12-14,18-19H,10-11H2,1-9H3.
What are the key properties of 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine?
2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine has a molecular weight of 268.49 g/mol, XLogP of 4.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,5-bis(2-methylbutan-2-yl)imidazolidine is sourced from PubChem (CID 140580755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).