C31H42N6O4 — CID 140580855
tert-butyl 9-[2-(3-methyl-4-morpholin-4-ylanilino)furo[3,2-d]pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecane-2-carboxylate (PubChem CID 140580855) has the molecular formula C31H42N6O4 and a molecular weight of 562.72 g/mol. Its IUPAC name is tert-butyl 9-[2-(3-methyl-4-morpholin-4-ylanilino)furo[3,2-d]pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecane-2-carboxylate.
| Compound Name | tert-butyl 9-[2-(3-methyl-4-morpholin-4-ylanilino)furo[3,2-d]pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecane-2-carboxylate |
|---|---|
| PubChem CID | 140580855 |
| Molecular Formula | C31H42N6O4 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | tert-butyl 9-[2-(3-methyl-4-morpholin-4-ylanilino)furo[3,2-d]pyrimidin-4-yl]-2,9-diazaspiro[5.5]undecane-2-carboxylate |
| SMILES | Cc1cc(Nc2nc(N3CCC4(CCCN(C(=O)OC(C)(C)C)C4)CC3)c3occc3n2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C31H42N6O4/c1-22-20-23(6-7-25(22)35-15-18-39-19-16-35)32-28-33-24-8-17-40-26(24)27(34-28)36-13-10-31(11-14-36)9-5-12-37(21-31)29(38)41-30(2,3)4/h6-8,17,20H,5,9-16,18-19,21H2,1-4H3,(H,32,33,34) |
| InChIKey | BPPXEPNMCMZEQD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 96.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|