About dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate)
dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) (PubChem CID 140581629) has the molecular formula C9H16K2O7-2
and a molecular weight of 314.42 g/mol. Its IUPAC name is dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate).
Molecular Properties
| Compound Name | dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) |
| PubChem CID | 140581629 |
| Molecular Formula | C9H16K2O7-2 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) |
| SMILES | [K+].[K+].[O-]CC(O)C[O-].[O-]CC1CO1.[O-]CC1CO1 |
| InChI | InChI=1S/C3H6O3.2C3H5O2.2K/c4-1-3(6)2-5;2*4-1-3-2-5-3;;/h3,6H,1-2H2;2*3H,1-2H2;;/q-2;2*-1;2*+1 |
| InChIKey | DQQJQRBRGRWDAU-UHFFFAOYSA-N |
| XLogP | -11.43 |
| TPSA | 137.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | -11.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate)?
The IUPAC name of dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) (CID 140581629) is dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate).
What is the SMILES notation for dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate)?
The canonical SMILES for dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) is [K+].[K+].[O-]CC(O)C[O-].[O-]CC1CO1.[O-]CC1CO1.
What is the InChIKey of dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate)?
The InChIKey is DQQJQRBRGRWDAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.2C3H5O2.2K/c4-1-3(6)2-5;2*4-1-3-2-5-3;;/h3,6H,1-2H2;2*3H,1-2H2;;/q-2;2*-1;2*+1.
What are the key properties of dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate)?
dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) has a molecular weight of 314.42 g/mol, XLogP of -11.43, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-hydroxypropane-1,3-diolate;bis(oxiran-2-ylmethanolate) is sourced from PubChem (CID 140581629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).