C18H24O12 — CID 140582376
[(2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2,3-bis(2-methylprop-2-enoyloxy)oxan-4-yl] 2-methylprop-2-enoate (PubChem CID 140582376) has the molecular formula C18H24O12 and a molecular weight of 432.38 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2,3-bis(2-methylprop-2-enoyloxy)oxan-4-yl] 2-methylprop-2-enoate.
| Compound Name | [(2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2,3-bis(2-methylprop-2-enoyloxy)oxan-4-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140582376 |
| Molecular Formula | C18H24O12 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)-2,3-bis(2-methylprop-2-enoyloxy)oxan-4-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@]1(O)O[C@H](CO)[C@@H](O)[C@@](O)(OC(=O)C(=C)C)[C@]1(O)OC(=O)C(=C)C |
| InChI | InChI=1S/C18H24O12/c1-8(2)13(21)28-16(24)12(20)11(7-19)27-18(26,30-15(23)10(5)6)17(16,25)29-14(22)9(3)4/h11-12,19-20,24-26H,1,3,5,7H2,2,4,6H3/t11-,12-,16-,17+,18+/m1/s1 |
| InChIKey | BPLHIIMPXFXHNF-LZSAZEBISA-N |
| XLogP | -1.88 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|