About (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate)
(bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) (PubChem CID 140582891) has the molecular formula C17H36O7Si3
and a molecular weight of 436.73 g/mol.
Molecular Properties
| Compound Name | (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) |
| PubChem CID | 140582891 |
| Molecular Formula | C17H36O7Si3 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | — |
| SMILES | CCC(/C=C(\C)C(=O)OC(O)C(O)CO)[Si]C(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O7Si3/c1-9-13(10-12(2)15(20)22-16(21)14(19)11-18)25-17(23-26(3,4)5)24-27(6,7)8/h10,13-14,16-19,21H,9,11H2,1-8H3/b12-10+ |
| InChIKey | VAEHJNCQBFJIJH-ZRDIBKRKSA-N |
| XLogP | 2.04 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate)?
The IUPAC name of (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) (CID 140582891) is not available.
What is the SMILES notation for (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate)?
The canonical SMILES for (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) is CCC(/C=C(\C)C(=O)OC(O)C(O)CO)[Si]C(O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate)?
The InChIKey is VAEHJNCQBFJIJH-ZRDIBKRKSA-N. The full InChI is InChI=1S/C17H36O7Si3/c1-9-13(10-12(2)15(20)22-16(21)14(19)11-18)25-17(23-26(3,4)5)24-27(6,7)8/h10,13-14,16-19,21H,9,11H2,1-8H3/b12-10+.
What are the key properties of (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate)?
(bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) has a molecular weight of 436.73 g/mol, XLogP of 2.04, 12 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (bis(trimethylsilyloxy)methylsilylpropyl glycerol methacrylate) is sourced from PubChem (CID 140582891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).