C22H29N5O2S — CID 140583632
N-[(E,3S)-6-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide (PubChem CID 140583632) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(E,3S)-6-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide.
| Compound Name | N-[(E,3S)-6-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 140583632 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[(E,3S)-6-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-6-oxo-1-phenylhex-4-en-3-yl]piperidine-2-carboxamide |
| SMILES | CCc1nnc(NC(=O)/C=C/[C@H](CCc2ccccc2)NC(=O)C2CCCCN2)s1 |
| InChI | InChI=1S/C22H29N5O2S/c1-2-20-26-27-22(30-20)25-19(28)14-13-17(12-11-16-8-4-3-5-9-16)24-21(29)18-10-6-7-15-23-18/h3-5,8-9,13-14,17-18,23H,2,6-7,10-12,15H2,1H3,(H,24,29)(H,25,27,28)/b14-13+/t17-,18?/m0/s1 |
| InChIKey | SOGRFVSGNLHWME-CDZVJMEDSA-N |
| XLogP | 2.85 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|