C48H50ClF2N2Pt — CID 140584426
chloroplatinum;2-[2,4-difluoro-5-[5-[2-(4-octylphenyl)ethynyl]-2-pyridinyl]phenyl]-5-[2-(4-octylphenyl)ethynyl]pyridine (PubChem CID 140584426) has the molecular formula C48H50ClF2N2Pt and a molecular weight of 923.47 g/mol. Its IUPAC name is chloroplatinum;2-[2,4-difluoro-5-[5-[2-(4-octylphenyl)ethynyl]-2-pyridinyl]phenyl]-5-[2-(4-octylphenyl)ethynyl]pyridine.
| Compound Name | chloroplatinum;2-[2,4-difluoro-5-[5-[2-(4-octylphenyl)ethynyl]-2-pyridinyl]phenyl]-5-[2-(4-octylphenyl)ethynyl]pyridine |
|---|---|
| PubChem CID | 140584426 |
| Molecular Formula | C48H50ClF2N2Pt |
| Molecular Weight | 923.47 g/mol |
| Exact Mass | 922.33 |
| IUPAC Name | chloroplatinum;2-[2,4-difluoro-5-[5-[2-(4-octylphenyl)ethynyl]-2-pyridinyl]phenyl]-5-[2-(4-octylphenyl)ethynyl]pyridine |
| SMILES | CCCCCCCCc1ccc(C#Cc2ccc(-c3cc(-c4ccc(C#Cc5ccc(CCCCCCCC)cc5)cn4)c(F)cc3F)nc2)cc1.Cl[Pt] |
| InChI | InChI=1S/C48H50F2N2.ClH.Pt/c1-3-5-7-9-11-13-15-37-17-21-39(22-18-37)25-27-41-29-31-47(51-35-41)43-33-44(46(50)34-45(43)49)48-32-30-42(36-52-48)28-26-40-23-19-38(20-24-40)16-14-12-10-8-6-4-2;;/h17-24,29-36H,3-16H2,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | MKMGLBGRPVNDTM-UHFFFAOYSA-M |
| XLogP | 13.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.47 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|