C15H6F4N2 — CID 140584847
3,5,6,10-tetrafluoroimidazo[1,2-f]phenanthridine (PubChem CID 140584847) has the molecular formula C15H6F4N2 and a molecular weight of 290.22 g/mol. Its IUPAC name is 3,5,6,10-tetrafluoroimidazo[1,2-f]phenanthridine.
| Compound Name | 3,5,6,10-tetrafluoroimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 140584847 |
| Molecular Formula | C15H6F4N2 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3,5,6,10-tetrafluoroimidazo[1,2-f]phenanthridine |
| SMILES | Fc1ccc2c(c1)c1ccc(F)c(F)c1n1c(F)cnc21 |
| InChI | InChI=1S/C15H6F4N2/c16-7-1-2-9-10(5-7)8-3-4-11(17)13(19)14(8)21-12(18)6-20-15(9)21/h1-6H |
| InChIKey | SUUUTXGHJCZZIX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|