C15H5F5N2 — CID 140584983
3,5,6,8,10-pentafluoroimidazo[1,2-f]phenanthridine (PubChem CID 140584983) has the molecular formula C15H5F5N2 and a molecular weight of 308.21 g/mol. Its IUPAC name is 3,5,6,8,10-pentafluoroimidazo[1,2-f]phenanthridine.
| Compound Name | 3,5,6,8,10-pentafluoroimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 140584983 |
| Molecular Formula | C15H5F5N2 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3,5,6,8,10-pentafluoroimidazo[1,2-f]phenanthridine |
| SMILES | Fc1ccc2c(c1)c1c(F)cc(F)c(F)c1n1c(F)cnc21 |
| InChI | InChI=1S/C15H5F5N2/c16-6-1-2-7-8(3-6)12-9(17)4-10(18)13(20)14(12)22-11(19)5-21-15(7)22/h1-5H |
| InChIKey | BZQRCLAPAVWLHG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|