C25H32N8O5 — CID 14058547
2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]decanedioic acid (PubChem CID 14058547) has the molecular formula C25H32N8O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]decanedioic acid.
| Compound Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]decanedioic acid |
|---|---|
| PubChem CID | 14058547 |
| Molecular Formula | C25H32N8O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]decanedioic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCCCCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H32N8O5/c1-33(14-16-13-28-22-20(29-16)21(26)31-25(27)32-22)17-11-9-15(10-12-17)23(36)30-18(24(37)38)7-5-3-2-4-6-8-19(34)35/h9-13,18H,2-8,14H2,1H3,(H,30,36)(H,34,35)(H,37,38)(H4,26,27,28,31,32) |
| InChIKey | XIBOENYPCYGVLJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|