C26H34N8O5 — CID 14058548
2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]undecanedioic acid (PubChem CID 14058548) has the molecular formula C26H34N8O5 and a molecular weight of 538.61 g/mol. Its IUPAC name is 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]undecanedioic acid.
| Compound Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]undecanedioic acid |
|---|---|
| PubChem CID | 14058548 |
| Molecular Formula | C26H34N8O5 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]undecanedioic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCCCCCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C26H34N8O5/c1-34(15-17-14-29-23-21(30-17)22(27)32-26(28)33-23)18-12-10-16(11-13-18)24(37)31-19(25(38)39)8-6-4-2-3-5-7-9-20(35)36/h10-14,19H,2-9,15H2,1H3,(H,31,37)(H,35,36)(H,38,39)(H4,27,28,29,32,33) |
| InChIKey | YJXSKQUFQMCYMU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|