C27H36N8O5 — CID 14058549
2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]dodecanedioic acid (PubChem CID 14058549) has the molecular formula C27H36N8O5 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]dodecanedioic acid.
| Compound Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]dodecanedioic acid |
|---|---|
| PubChem CID | 14058549 |
| Molecular Formula | C27H36N8O5 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]dodecanedioic acid |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCCCCCCCCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C27H36N8O5/c1-35(16-18-15-30-24-22(31-18)23(28)33-27(29)34-24)19-13-11-17(12-14-19)25(38)32-20(26(39)40)9-7-5-3-2-4-6-8-10-21(36)37/h11-15,20H,2-10,16H2,1H3,(H,32,38)(H,36,37)(H,39,40)(H4,28,29,30,33,34) |
| InChIKey | FULMXKJWMKHWBC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 210.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|