C25H23N3 — CID 140585839
N,N-diphenyl-3-(3,5,6-trimethylpyrazin-2-yl)aniline (PubChem CID 140585839) has the molecular formula C25H23N3 and a molecular weight of 365.48 g/mol. Its IUPAC name is N,N-diphenyl-3-(3,5,6-trimethylpyrazin-2-yl)aniline.
| Compound Name | N,N-diphenyl-3-(3,5,6-trimethylpyrazin-2-yl)aniline |
|---|---|
| PubChem CID | 140585839 |
| Molecular Formula | C25H23N3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N,N-diphenyl-3-(3,5,6-trimethylpyrazin-2-yl)aniline |
| SMILES | Cc1nc(C)c(-c2cccc(N(c3ccccc3)c3ccccc3)c2)nc1C |
| InChI | InChI=1S/C25H23N3/c1-18-19(2)27-25(20(3)26-18)21-11-10-16-24(17-21)28(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-17H,1-3H3 |
| InChIKey | PAIKYAZQUFDVNR-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |