C10H20O9S2 — CID 140586886
[(2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1-hydroxy-3-methoxybutan-2-yl] sulfate (PubChem CID 140586886) has the molecular formula C10H20O9S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is [(2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1-hydroxy-3-methoxybutan-2-yl] sulfate.
| Compound Name | [(2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1-hydroxy-3-methoxybutan-2-yl] sulfate |
|---|---|
| PubChem CID | 140586886 |
| Molecular Formula | C10H20O9S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [(2S,3S)-4-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-1-hydroxy-3-methoxybutan-2-yl] sulfate |
| SMILES | CO[C@H](C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO)[C@H](CO)OS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H20O9S2/c1-18-8(7(2-11)19-21(15,16)17)5-20-4-6(13)10(14)9(20)3-12/h6-14H,2-5H2,1H3/t6-,7+,8-,9-,10+,20?/m1/s1 |
| InChIKey | VYGRBIODMMNXHB-HJAHRDJHSA-N |
| XLogP | -3.45 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|