C93H90Al2N6O6 — CID 140587361
2-N,7-N-bis[4-[4-di(quinolin-8-yloxy)alumanyloxyphenyl]phenyl]-2-N,7-N,3,6-tetramethyl-9,9-dioctylfluorene-2,7-diamine (PubChem CID 140587361) has the molecular formula C93H90Al2N6O6 and a molecular weight of 1441.74 g/mol. Its IUPAC name is 2-N,7-N-bis[4-[4-di(quinolin-8-yloxy)alumanyloxyphenyl]phenyl]-2-N,7-N,3,6-tetramethyl-9,9-dioctylfluorene-2,7-diamine.
| Compound Name | 2-N,7-N-bis[4-[4-di(quinolin-8-yloxy)alumanyloxyphenyl]phenyl]-2-N,7-N,3,6-tetramethyl-9,9-dioctylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 140587361 |
| Molecular Formula | C93H90Al2N6O6 |
| Molecular Weight | 1441.74 g/mol |
| Exact Mass | 1440.66 |
| IUPAC Name | 2-N,7-N-bis[4-[4-di(quinolin-8-yloxy)alumanyloxyphenyl]phenyl]-2-N,7-N,3,6-tetramethyl-9,9-dioctylfluorene-2,7-diamine |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(N(C)c3ccc(-c4ccc(O[Al](Oc5cccc6cccnc56)Oc5cccc6cccnc56)cc4)cc3)c(C)cc2-c2cc(C)c(N(C)c3ccc(-c4ccc(O[Al](Oc5cccc6cccnc56)Oc5cccc6cccnc56)cc4)cc3)cc21 |
| InChI | InChI=1S/C57H68N2O2.4C9H7NO.2Al/c1-7-9-11-13-15-17-35-57(36-18-16-14-12-10-8-2)53-39-55(58(5)47-27-19-43(20-28-47)45-23-31-49(60)32-24-45)41(3)37-51(53)52-38-42(4)56(40-54(52)57)59(6)48-29-21-44(22-30-48)46-25-33-50(61)34-26-46;4*11-8-5-1-3-7-4-2-6-10-9(7)8;;/h19-34,37-40,60-61H,7-18,35-36H2,1-6H3;4*1-6,11H;;/q;;;;;2*+3/p-6 |
| InChIKey | MXODKACQLJCFSG-UHFFFAOYSA-H |
| XLogP | 24.18 |
| TPSA | 113.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 107 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1441.74 |
| LogP ≤ 5 | 24.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|