C11H23N3O — CID 140587728
(2S)-2-amino-1-[4-(cyclopropylmethyl)piperazin-1-yl]propan-2-ol (PubChem CID 140587728) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is (2S)-2-amino-1-[4-(cyclopropylmethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-2-amino-1-[4-(cyclopropylmethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 140587728 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | (2S)-2-amino-1-[4-(cyclopropylmethyl)piperazin-1-yl]propan-2-ol |
| SMILES | C[C@](N)(O)CN1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-11(12,15)9-14-6-4-13(5-7-14)8-10-2-3-10/h10,15H,2-9,12H2,1H3/t11-/m0/s1 |
| InChIKey | XXAXJFZEMZLVGG-NSHDSACASA-N |
| XLogP | -0.32 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|