C37H48Si — CID 140589121
tris(3,5-diethylphenyl)-(2,5-dimethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 140589121) has the molecular formula C37H48Si and a molecular weight of 520.88 g/mol. Its IUPAC name is tris(3,5-diethylphenyl)-(2,5-dimethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(3,5-diethylphenyl)-(2,5-dimethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 140589121 |
| Molecular Formula | C37H48Si |
| Molecular Weight | 520.88 g/mol |
| Exact Mass | 520.35 |
| IUPAC Name | tris(3,5-diethylphenyl)-(2,5-dimethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CCc1cc(CC)cc([Si](C2=C(C)C=CC2C)(c2cc(CC)cc(CC)c2)c2cc(CC)cc(CC)c2)c1 |
| InChI | InChI=1S/C37H48Si/c1-9-28-17-29(10-2)21-34(20-28)38(37-26(7)15-16-27(37)8,35-22-30(11-3)18-31(12-4)23-35)36-24-32(13-5)19-33(14-6)25-36/h15-26H,9-14H2,1-8H3 |
| InChIKey | ARFCDEHNWRXXDJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.88 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|