C14H10N2O2S2 — CID 14058927
(3Z,6Z)-3,6-bis(thiophen-2-ylmethylidene)piperazine-2,5-dione (PubChem CID 14058927) has the molecular formula C14H10N2O2S2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (3Z,6Z)-3,6-bis(thiophen-2-ylmethylidene)piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3,6-bis(thiophen-2-ylmethylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 14058927 |
| Molecular Formula | C14H10N2O2S2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | (3Z,6Z)-3,6-bis(thiophen-2-ylmethylidene)piperazine-2,5-dione |
| SMILES | O=c1[nH]/c(=C\c2cccs2)c(=O)[nH]/c1=C\c1cccs1 |
| InChI | InChI=1S/C14H10N2O2S2/c17-13-11(7-9-3-1-5-19-9)15-14(18)12(16-13)8-10-4-2-6-20-10/h1-8H,(H,15,18)(H,16,17)/b11-7-,12-8- |
| InChIKey | JZPNSRWFKPZIFU-OXAWKVHCSA-N |
| XLogP | 0.84 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |