C18H22N2O4S — CID 140589448
2-(4-hexylsulfanyl-3-nitrophenyl)-2,3-dihydro-1H-azepine-4,7-dione (PubChem CID 140589448) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 2-(4-hexylsulfanyl-3-nitrophenyl)-2,3-dihydro-1H-azepine-4,7-dione.
| Compound Name | 2-(4-hexylsulfanyl-3-nitrophenyl)-2,3-dihydro-1H-azepine-4,7-dione |
|---|---|
| PubChem CID | 140589448 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-(4-hexylsulfanyl-3-nitrophenyl)-2,3-dihydro-1H-azepine-4,7-dione |
| SMILES | CCCCCCSc1ccc(C2CC(=O)C=CC(=O)N2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H22N2O4S/c1-2-3-4-5-10-25-17-8-6-13(11-16(17)20(23)24)15-12-14(21)7-9-18(22)19-15/h6-9,11,15H,2-5,10,12H2,1H3,(H,19,22) |
| InChIKey | SOYHVXINRAYYDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|