C25H32N4 — CID 140589591
N,N'-dimethyl-N,N'-bis[(1-methylindol-3-yl)methyl]propane-1,3-diamine (PubChem CID 140589591) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis[(1-methylindol-3-yl)methyl]propane-1,3-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis[(1-methylindol-3-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 140589591 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis[(1-methylindol-3-yl)methyl]propane-1,3-diamine |
| SMILES | CN(CCCN(C)Cc1cn(C)c2ccccc12)Cc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C25H32N4/c1-26(16-20-18-28(3)24-12-7-5-10-22(20)24)14-9-15-27(2)17-21-19-29(4)25-13-8-6-11-23(21)25/h5-8,10-13,18-19H,9,14-17H2,1-4H3 |
| InChIKey | AFGAMNSRMJQYQA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |