About [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone
[2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone (PubChem CID 140590053) has the molecular formula C6H4N2O2S
and a molecular weight of 168.18 g/mol. Its IUPAC name is [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone.
Molecular Properties
| Compound Name | [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone |
| PubChem CID | 140590053 |
| Molecular Formula | C6H4N2O2S |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone |
| SMILES | N=S(=O)=C1N=CC=CC1=C=O |
| InChI | InChI=1S/C6H4N2O2S/c7-11(10)6-5(4-9)2-1-3-8-6/h1-3,7H |
| InChIKey | HCAWBICEOKEJQD-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone?
The IUPAC name of [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone (CID 140590053) is [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone.
What is the SMILES notation for [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone?
The canonical SMILES for [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone is N=S(=O)=C1N=CC=CC1=C=O.
What is the InChIKey of [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone?
The InChIKey is HCAWBICEOKEJQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2S/c7-11(10)6-5(4-9)2-1-3-8-6/h1-3,7H.
What are the key properties of [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone?
[2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone has a molecular weight of 168.18 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[imino(oxo)-λ6-sulfanylidene]-3-pyridinylidene]methanone is sourced from PubChem (CID 140590053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).