C16H19N5O2 — CID 140590651
2-[C-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)carbonohydrazonoyl]phenol (PubChem CID 140590651) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[C-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)carbonohydrazonoyl]phenol.
| Compound Name | 2-[C-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)carbonohydrazonoyl]phenol |
|---|---|
| PubChem CID | 140590651 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[C-(2-methyl-6-morpholin-4-ylpyrimidin-4-yl)carbonohydrazonoyl]phenol |
| SMILES | Cc1nc(C(=NN)c2ccccc2O)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H19N5O2/c1-11-18-13(10-15(19-11)21-6-8-23-9-7-21)16(20-17)12-4-2-3-5-14(12)22/h2-5,10,22H,6-9,17H2,1H3 |
| InChIKey | QIKRATZALVNKFT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|