C12H13F2NO3S — CID 140590712
2-(2,4-difluoro-5-propan-2-yloxypenta-1,3-dien-3-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 140590712) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-(2,4-difluoro-5-propan-2-yloxypenta-1,3-dien-3-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(2,4-difluoro-5-propan-2-yloxypenta-1,3-dien-3-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 140590712 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-(2,4-difluoro-5-propan-2-yloxypenta-1,3-dien-3-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | C=C(F)C(=C(F)COC(C)C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C12H13F2NO3S/c1-6(2)18-4-8(14)10(7(3)13)11-15-9(5-19-11)12(16)17/h5-6H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | YBPYAPMQDVVUOY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|