C46H56N2 — CID 140591528
2-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-5-decylpyrimidine (PubChem CID 140591528) has the molecular formula C46H56N2 and a molecular weight of 636.97 g/mol. Its IUPAC name is 2-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-5-decylpyrimidine.
| Compound Name | 2-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-5-decylpyrimidine |
|---|---|
| PubChem CID | 140591528 |
| Molecular Formula | C46H56N2 |
| Molecular Weight | 636.97 g/mol |
| Exact Mass | 636.44 |
| IUPAC Name | 2-[3-[3,5-bis(4-tert-butylphenyl)phenyl]phenyl]-5-decylpyrimidine |
| SMILES | CCCCCCCCCCc1cnc(-c2cccc(-c3cc(-c4ccc(C(C)(C)C)cc4)cc(-c4ccc(C(C)(C)C)cc4)c3)c2)nc1 |
| InChI | InChI=1S/C46H56N2/c1-8-9-10-11-12-13-14-15-17-34-32-47-44(48-33-34)38-19-16-18-37(28-38)41-30-39(35-20-24-42(25-21-35)45(2,3)4)29-40(31-41)36-22-26-43(27-23-36)46(5,6)7/h16,18-33H,8-15,17H2,1-7H3 |
| InChIKey | CUXJUYRRWWAPOJ-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.97 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|