C27H30F4IrN3O2- — CID 140591590
5-decyl-2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]pyrimidine;iridium;pyridine-2-carboxylic acid (PubChem CID 140591590) has the molecular formula C27H30F4IrN3O2- and a molecular weight of 696.76 g/mol. Its IUPAC name is 5-decyl-2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]pyrimidine;iridium;pyridine-2-carboxylic acid.
| Compound Name | 5-decyl-2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]pyrimidine;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 140591590 |
| Molecular Formula | C27H30F4IrN3O2- |
| Molecular Weight | 696.76 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | 5-decyl-2-[4-fluoro-3-(trifluoromethyl)benzene-6-id-1-yl]pyrimidine;iridium;pyridine-2-carboxylic acid |
| SMILES | CCCCCCCCCCc1cnc(-c2[c-]cc(F)c(C(F)(F)F)c2)nc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C21H25F4N2.C6H5NO2.Ir/c1-2-3-4-5-6-7-8-9-10-16-14-26-20(27-15-16)17-11-12-19(22)18(13-17)21(23,24)25;8-6(9)5-3-1-2-4-7-5;/h12-15H,2-10H2,1H3;1-4H,(H,8,9);/q-1;; |
| InChIKey | QCMUGWLVDGHIHL-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.76 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|