C27H43NO7 — CID 14059164
14-ethyl-4,6,19,21-tetramethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane (PubChem CID 14059164) has the molecular formula C27H43NO7 and a molecular weight of 493.64 g/mol. Its IUPAC name is 14-ethyl-4,6,19,21-tetramethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane.
| Compound Name | 14-ethyl-4,6,19,21-tetramethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane |
|---|---|
| PubChem CID | 14059164 |
| Molecular Formula | C27H43NO7 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | 14-ethyl-4,6,19,21-tetramethoxy-16-(methoxymethyl)-9,11-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,8.08,12.016,20]docosane |
| SMILES | CCN1CC2(COC)CCC(OC)C34C5CC6C(OC)CC7(OCOC7(C(OC)C23)C14)C5C6OC |
| InChI | InChI=1S/C27H43NO7/c1-7-28-12-24(13-29-2)9-8-18(31-4)26-16-10-15-17(30-3)11-25(19(16)20(15)32-5)27(23(26)28,35-14-34-25)22(33-6)21(24)26/h15-23H,7-14H2,1-6H3 |
| InChIKey | ZXIRRKBJKCADDR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |