C37H37N2O7S2- — CID 140592305
2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(3-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate (PubChem CID 140592305) has the molecular formula C37H37N2O7S2- and a molecular weight of 685.84 g/mol. Its IUPAC name is 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(3-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate.
| Compound Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(3-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 140592305 |
| Molecular Formula | C37H37N2O7S2- |
| Molecular Weight | 685.84 g/mol |
| Exact Mass | 685.20 |
| IUPAC Name | 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(3-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)[O-])cc2)c2cc(-c3cccc(-c4cccc(S(C)(=O)=O)c4)c3)on2)cc1 |
| InChI | InChI=1S/C37H38N2O7S2/c1-37(2,3)31-17-15-26(16-18-31)33(21-25-11-13-27(14-12-25)36(40)38-19-20-48(43,44)45)34-24-35(46-39-34)30-9-5-7-28(22-30)29-8-6-10-32(23-29)47(4,41)42/h5-18,22-24,33H,19-21H2,1-4H3,(H,38,40)(H,43,44,45)/p-1 |
| InChIKey | DYCMOKPDRRININ-UHFFFAOYSA-M |
| XLogP | 6.36 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|