C30H24N6 — CID 140592586
2,12-bis(1-methylimidazol-2-yl)-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8(23),9,11,13,15,17,19-undecaene (PubChem CID 140592586) has the molecular formula C30H24N6 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2,12-bis(1-methylimidazol-2-yl)-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8(23),9,11,13,15,17,19-undecaene.
| Compound Name | 2,12-bis(1-methylimidazol-2-yl)-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8(23),9,11,13,15,17,19-undecaene |
|---|---|
| PubChem CID | 140592586 |
| Molecular Formula | C30H24N6 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2,12-bis(1-methylimidazol-2-yl)-21,23-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(21),2,4,6,8(23),9,11,13,15,17,19-undecaene |
| SMILES | Cn1ccnc1/C1=C2\C=C/C(=C/C3=N/C(=C(/c4nccn4C)C4=CC=C(/C=C5/C=CC1=N5)C4)C=C3)C2 |
| InChI | InChI=1S/C30H24N6/c1-35-13-11-31-29(35)27-21-5-3-19(15-21)17-24-8-10-26(34-24)28(30-32-12-14-36(30)2)22-6-4-20(16-22)18-23-7-9-25(27)33-23/h3-14,17-18H,15-16H2,1-2H3/b19-17-,20-18-,23-18-,24-17-,27-21+,27-25+,28-22+,28-26+ |
| InChIKey | WVXVUIIANDZSPK-MLWUPSGGSA-N |
| XLogP | 5.38 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |