C39H33N3O2Pt — CID 140593990
3-[2,6-di(propan-2-yl)phenyl]-11-[3-[(4-methyl-2-pyridinyl)oxy]benzene-2-id-1-yl]oxy-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) (PubChem CID 140593990) has the molecular formula C39H33N3O2Pt and a molecular weight of 770.79 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-11-[3-[(4-methyl-2-pyridinyl)oxy]benzene-2-id-1-yl]oxy-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+).
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-11-[3-[(4-methyl-2-pyridinyl)oxy]benzene-2-id-1-yl]oxy-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
|---|---|
| PubChem CID | 140593990 |
| Molecular Formula | C39H33N3O2Pt |
| Molecular Weight | 770.79 g/mol |
| Exact Mass | 770.22 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-11-[3-[(4-methyl-2-pyridinyl)oxy]benzene-2-id-1-yl]oxy-12H-imidazo[1,2-f]phenanthridin-12-ide;platinum(2+) |
| SMILES | Cc1ccnc(Oc2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n3c(-c5c(C(C)C)cccc5C(C)C)cnc43)ccc2)c1.[Pt+2] |
| InChI | InChI=1S/C39H33N3O2.Pt/c1-24(2)30-13-9-14-31(25(3)4)38(30)36-23-41-39-34-22-29(16-17-32(34)33-12-6-7-15-35(33)42(36)39)43-27-10-8-11-28(21-27)44-37-20-26(5)18-19-40-37;/h6-20,23-25H,1-5H3;/q-2;+2 |
| InChIKey | CGTKHMSQZDEUOM-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.79 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|