C23H29O10P-2 — CID 140595139
1-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]propyl phosphate (PubChem CID 140595139) has the molecular formula C23H29O10P-2 and a molecular weight of 496.45 g/mol. Its IUPAC name is 1-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]propyl phosphate.
| Compound Name | 1-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]propyl phosphate |
|---|---|
| PubChem CID | 140595139 |
| Molecular Formula | C23H29O10P-2 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[[(1S,2S,4S,5S,7S,8R,9R,11S,13S)-1-methyl-17-oxo-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-en-8-yl]oxy]propyl phosphate |
| SMILES | CCC(O[C@@H]1[C@@]2(C(C)C)O[C@H]2[C@@H]2O[C@]23[C@]12O[C@H]2C[C@H]1C2=C(CC[C@@]13C)C(=O)OC2)OP(=O)([O-])[O-] |
| InChI | InChI=1S/C23H31O10P/c1-5-15(33-34(25,26)27)29-19-21(10(2)3)16(31-21)17-23(32-17)20(4)7-6-11-12(9-28-18(11)24)13(20)8-14-22(19,23)30-14/h10,13-17,19H,5-9H2,1-4H3,(H2,25,26,27)/p-2/t13-,14-,15?,16-,17-,19+,20-,21-,22+,23+/m0/s1 |
| InChIKey | BHUYXGPHGZDXTH-LVNYBPIFSA-L |
| XLogP | 0.71 |
| TPSA | 145.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|