C12H20FNS — CID 140595541
1-fluoro-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine (PubChem CID 140595541) has the molecular formula C12H20FNS and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-fluoro-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine.
| Compound Name | 1-fluoro-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
|---|---|
| PubChem CID | 140595541 |
| Molecular Formula | C12H20FNS |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-fluoro-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
| SMILES | FC1CCCC2SC3CCCCC3NC12 |
| InChI | InChI=1S/C12H20FNS/c13-8-4-3-7-11-12(8)14-9-5-1-2-6-10(9)15-11/h8-12,14H,1-7H2 |
| InChIKey | QSYRHVCMCXYYNT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |