C14H25NS — CID 140595547
1,9-dimethyl-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine (PubChem CID 140595547) has the molecular formula C14H25NS and a molecular weight of 239.43 g/mol. Its IUPAC name is 1,9-dimethyl-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine.
| Compound Name | 1,9-dimethyl-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
|---|---|
| PubChem CID | 140595547 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 1,9-dimethyl-2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenothiazine |
| SMILES | CC1CCCC2SC3CCCC(C)C3NC12 |
| InChI | InChI=1S/C14H25NS/c1-9-5-3-7-11-13(9)15-14-10(2)6-4-8-12(14)16-11/h9-15H,3-8H2,1-2H3 |
| InChIKey | NRQWYKSUPOPMNJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |