C32H52O4 — CID 14059564
methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-5-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 14059564) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-5-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-5-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 14059564 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | methyl (4aR,5R,6aR,6aS,6bR,8aR,10S,12aR,14bS)-10-hydroxy-5-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1C1=CC[C@@H]3[C@@]4(C)CC[C@H](O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)C[C@H]2OC |
| InChI | InChI=1S/C32H52O4/c1-27(2)16-17-32(26(34)36-9)21(18-27)20-10-11-23-29(5)14-13-24(33)28(3,4)22(29)12-15-30(23,6)31(20,7)19-25(32)35-8/h10,21-25,33H,11-19H2,1-9H3/t21-,22-,23+,24-,25+,29-,30+,31+,32+/m0/s1 |
| InChIKey | IHRHTDQKYPZUPA-ZQKOLQPVSA-N |
| XLogP | 6.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|