About 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide
2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide (PubChem CID 140595700) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide.
Molecular Properties
| Compound Name | 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide |
| PubChem CID | 140595700 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide |
| SMILES | CCCCN1OC[C@@H](c2ccccc2C(N)=O)C1=O |
| InChI | InChI=1S/C14H18N2O3/c1-2-3-8-16-14(18)12(9-19-16)10-6-4-5-7-11(10)13(15)17/h4-7,12H,2-3,8-9H2,1H3,(H2,15,17)/t12-/m0/s1 |
| InChIKey | JSORPCRKXXJPMN-LBPRGKRZSA-N |
| XLogP | 1.44 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide?
The IUPAC name of 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide (CID 140595700) is 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide.
What is the SMILES notation for 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide?
The canonical SMILES for 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide is CCCCN1OC[C@@H](c2ccccc2C(N)=O)C1=O.
What is the InChIKey of 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide?
The InChIKey is JSORPCRKXXJPMN-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-2-3-8-16-14(18)12(9-19-16)10-6-4-5-7-11(10)13(15)17/h4-7,12H,2-3,8-9H2,1H3,(H2,15,17)/t12-/m0/s1.
What are the key properties of 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide?
2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide has a molecular weight of 262.31 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-2-butyl-3-oxo-1,2-oxazolidin-4-yl]benzamide is sourced from PubChem (CID 140595700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).