C22H26N6 — CID 140595738
2,4-ditert-butyl-6-[3-isocyano-5-(1-methylpyrazol-3-yl)phenyl]-1,3,5-triazine (PubChem CID 140595738) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-isocyano-5-(1-methylpyrazol-3-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-ditert-butyl-6-[3-isocyano-5-(1-methylpyrazol-3-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 140595738 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-isocyano-5-(1-methylpyrazol-3-yl)phenyl]-1,3,5-triazine |
| SMILES | [C-]#[N+]c1cc(-c2ccn(C)n2)cc(-c2nc(C(C)(C)C)nc(C(C)(C)C)n2)c1 |
| InChI | InChI=1S/C22H26N6/c1-21(2,3)19-24-18(25-20(26-19)22(4,5)6)15-11-14(12-16(13-15)23-7)17-9-10-28(8)27-17/h9-13H,1-6,8H3 |
| InChIKey | MSVLFSLQZRNFSZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|