C50H62N8O16 — CID 140595854
octakis(2-cyanoethyl) 1-methylheptadecane-1,3,5,7,9,11,13,15-octacarboxylate (PubChem CID 140595854) has the molecular formula C50H62N8O16 and a molecular weight of 1031.09 g/mol. Its IUPAC name is octakis(2-cyanoethyl) 1-methylheptadecane-1,3,5,7,9,11,13,15-octacarboxylate.
| Compound Name | octakis(2-cyanoethyl) 1-methylheptadecane-1,3,5,7,9,11,13,15-octacarboxylate |
|---|---|
| PubChem CID | 140595854 |
| Molecular Formula | C50H62N8O16 |
| Molecular Weight | 1031.09 g/mol |
| Exact Mass | 1030.43 |
| IUPAC Name | octakis(2-cyanoethyl) 1-methylheptadecane-1,3,5,7,9,11,13,15-octacarboxylate |
| SMILES | CCC(CC(CC(CC(CC(CC(CC(CC(C)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N)C(=O)OCCC#N |
| InChI | InChI=1S/C50H62N8O16/c1-3-36(44(60)68-21-5-13-52)29-38(46(62)70-23-7-15-54)31-40(48(64)72-25-9-17-56)33-42(50(66)74-27-11-19-58)34-41(49(65)73-26-10-18-57)32-39(47(63)71-24-8-16-55)30-37(45(61)69-22-6-14-53)28-35(2)43(59)67-20-4-12-51/h35-42H,3-11,20-34H2,1-2H3 |
| InChIKey | DVNJAOJXDKWVJC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 400.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.09 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|