C29H48FN3O2 — CID 140596590
N-(cyclohexylmethyl)-1-[1-[(4-fluorocyclohexyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]piperidine-4-carboxamide (PubChem CID 140596590) has the molecular formula C29H48FN3O2 and a molecular weight of 489.72 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-[1-[(4-fluorocyclohexyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(cyclohexylmethyl)-1-[1-[(4-fluorocyclohexyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 140596590 |
| Molecular Formula | C29H48FN3O2 |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | N-(cyclohexylmethyl)-1-[1-[(4-fluorocyclohexyl)methyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC1CCCCC1)C1CCN(C(=O)C2CC3CCCCC3N2CC2CCC(F)CC2)CC1 |
| InChI | InChI=1S/C29H48FN3O2/c30-25-12-10-22(11-13-25)20-33-26-9-5-4-8-24(26)18-27(33)29(35)32-16-14-23(15-17-32)28(34)31-19-21-6-2-1-3-7-21/h21-27H,1-20H2,(H,31,34) |
| InChIKey | VKFLHGCLZILTTD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |